Showing entry for Hydroxychavicol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0013692 |
| Compound Name | Hydroxychavicol |
| Structure | ![]() |
| Formula | C9H10O2 |
| InchiKey | FHEHIXJLCWUPCZ-UHFFFAOYSA-N |
| SMILES | C=CCc1ccc(c(c1)O)O |
| Inchi | InChI=1S/C9H10O2/c1-2-3-7-4-5-8(10)9(11)6-7/h2,4-6,10-11H,1,3H2 |
| IUPAC | 4-prop-2-enylbenzene-1,2-diol |
| Molecular Weight | 150.07 |
| Pubchem Id | 70775 |
| Chembl Id | CHEMBL111134 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL111134 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
