Showing entry for IKONNIKOSIDE I
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0014522 |
| Compound Name | IKONNIKOSIDE I |
| Structure | ![]() |
| Formula | C21H18O12 |
| InchiKey | ARCCSELFQKSKDR-ZFORQUDYSA-N |
| SMILES | OC(=O)[C@H]1O[C@@H](Oc2cc3oc(cc(=O)c3c(c2O)O)c2ccccc2O)[C@@H]([C@H]([C@@H]1O)O)O |
| Inchi | InChI=1S/C21H18O12/c22-8-4-2-1-3-7(8)10-5-9(23)13-11(31-10)6-12(14(24)15(13)25)32-21-18(28)16(26)17(27)19(33-21)20(29)30/h1-6,16-19,21-22,24-28H,(H,29,30)/t16-,17-,18+,19-,21+/m0/s1 |
| IUPAC | (2S,3S,4S,5R,6S)-6-[5,6-dihydroxy-2-(2-hydroxyphenyl)-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| Molecular Weight | 462.08 |
| Pubchem Id | 10183148 |
| Chembl Id | CHEMBL512609 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 50250624 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL512609 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
