Showing entry for sinaspirolide
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0015320 |
| Compound Name | sinaspirolide |
| Structure | ![]() |
| Formula | C25H28O4 |
| InchiKey | WXOFSAKMVZUYNE-ZHZULCJRSA-N |
| SMILES | CCC/C=C/1\OC(=O)C23C1(CCCC=C2)C1(C3CCC)OC(=O)c2c1cccc2 |
| Inchi | InChI=1S/C25H28O4/c1-3-5-14-20-24-16-10-6-9-15-23(24,22(27)28-20)19(11-4-2)25(24)18-13-8-7-12-17(18)21(26)29-25/h7-9,12-15,19H,3-6,10-11,16H2,1-2H3/b20-14- |
| IUPAC | |
| Molecular Weight | 392.2 |
| Pubchem Id | 44575264 |
| Chembl Id | CHEMBL519465 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL519465 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
