Showing entry for Lysianadioic Acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0015494 |
| Compound Name | Lysianadioic Acid |
| Structure | ![]() |
| Formula | C8H13N3O4 |
| InchiKey | FQUBLGQMXQHASY-DJWKRKHSSA-N |
| SMILES | NC(=N)NCC/C=C(\C(=O)O)/CC(=O)O |
| Inchi | InChI=1S/C8H13N3O4/c9-8(10)11-3-1-2-5(7(14)15)4-6(12)13/h2H,1,3-4H2,(H,12,13)(H,14,15)(H4,9,10,11)/b5-2- |
| IUPAC | (2Z)-2-[3-(diaminomethylideneamino)propylidene]butanedioic acid |
| Molecular Weight | 215.09 |
| Pubchem Id | 25110755 |
| Chembl Id | CHEMBL253846 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 50233004 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL253846 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
