Showing entry for 3-Ethyl-2,5-Dihydroxycyclohexa-2,5-Diene-1,4-Dione
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0017483 |
| Compound Name | 3-Ethyl-2,5-Dihydroxycyclohexa-2,5-Diene-1,4-Dione |
| Structure | ![]() |
| Formula | C8H8O4 |
| InchiKey | WJSQCAWGGRFZJK-UHFFFAOYSA-N |
| SMILES | CCC1=C(O)C(=O)C=C(C1=O)O |
| Inchi | InChI=1S/C8H8O4/c1-2-4-7(11)5(9)3-6(10)8(4)12/h3,9,12H,2H2,1H3 |
| IUPAC | 3-ethyl-2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
| Molecular Weight | 168.04 |
| Pubchem Id | 821411 |
| Chembl Id | CHEMBL222173 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL222173 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
