Showing entry for (R)-Pinocembrin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0017515 |
| Compound Name | (R)-Pinocembrin |
| Structure | ![]() |
| Formula | C15H12O4 |
| InchiKey | URFCJEUYXNAHFI-CYBMUJFWSA-N |
| SMILES | Oc1cc2O[C@H](CC(=O)c2c(c1)O)c1ccccc1 |
| Inchi | InChI=1S/C15H12O4/c16-10-6-11(17)15-12(18)8-13(19-14(15)7-10)9-4-2-1-3-5-9/h1-7,13,16-17H,8H2/t13-/m1/s1 |
| IUPAC | (2R)-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one |
| Molecular Weight | 256.07 |
| Pubchem Id | 667544 |
| Chembl Id | CHEMBL399249 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 26666 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL399249 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
