Showing entry for Mansonone F
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0017541 |
| Compound Name | Mansonone F |
| Structure | ![]() |
| Formula | C15H12O3 |
| InchiKey | WSRLWSPFIOAYST-UHFFFAOYSA-N |
| SMILES | CC1=C2OC=C(c3c2c(C(=O)C1=O)c(C)cc3)C |
| Inchi | InChI=1S/C15H12O3/c1-7-4-5-10-8(2)6-18-15-9(3)13(16)14(17)11(7)12(10)15/h4-6H,1-3H3 |
| IUPAC | |
| Molecular Weight | 240.08 |
| Pubchem Id | 94304 |
| Chembl Id | CHEMBL197655 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL197655 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
