Showing entry for 1,3,8-Trihydroxy-[1]Benzofuro[2,3-B]Chromen-11-One
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0017670 |
| Compound Name | 1,3,8-Trihydroxy-[1]Benzofuro[2,3-B]Chromen-11-One |
| Structure | ![]() |
| Formula | C15H8O6 |
| InchiKey | BBBAWACESCACAP-UHFFFAOYSA-N |
| SMILES | Oc1ccc2c(c1)oc1c2c(=O)c2c(o1)cc(cc2O)O |
| Inchi | InChI=1S/C15H8O6/c16-6-1-2-8-10(4-6)20-15-12(8)14(19)13-9(18)3-7(17)5-11(13)21-15/h1-5,16-18H |
| IUPAC | 1,3,8-trihydroxy-[1]benzofuro[2,3-b]chromen-11-one |
| Molecular Weight | 284.03 |
| Pubchem Id | 5324349 |
| Chembl Id | CHEMBL312186 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50130177 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL312186 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
