Showing entry for lappaconitine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0017878 |
| Compound Name | lappaconitine |
| Structure | ![]() |
| Formula | C32H44N2O8 |
| InchiKey | NWBWCXBPKTTZNQ-GZGPSRNVSA-N |
| SMILES | CCN1C[C@@]2(CC[C@@H]([C@]34C1[C@H](CC23)[C@@]1(O)C[C@@H]([C@H]2CC4[C@]1(O)[C@H]2OC)OC)OC)OC(=O)c1ccccc1N=C(O)C |
| Inchi | InChI=1S/C32H44N2O8/c1-6-34-16-29(42-28(36)18-9-7-8-10-21(18)33-17(2)35)12-11-25(40-4)31-23(29)14-20(26(31)34)30(37)15-22(39-3)19-13-24(31)32(30,38)27(19)41-5/h7-10,19-20,22-27,37-38H,6,11-16H2,1-5H3,(H,33,35)/t19-,20+,22+,23?,24?,25+,26?,27+,29-,30+,31+, |
| IUPAC | |
| Molecular Weight | 584.31 |
| Pubchem Id | 16464737 |
| Chembl Id | CHEMBL2112849 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50454435 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2112849 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
