Showing entry for alpha-Deoxycamptothecin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0018265 |
| Compound Name | alpha-Deoxycamptothecin |
| Structure | ![]() |
| Formula | C20H16N2O3 |
| InchiKey | PEZXVOHRDBYBFR-CYBMUJFWSA-N |
| SMILES | CC[C@H]1C(=O)OCc2c1cc1c3nc4ccccc4cc3Cn1c2=O |
| Inchi | InChI=1S/C20H16N2O3/c1-2-13-14-8-17-18-12(7-11-5-3-4-6-16(11)21-18)9-22(17)19(23)15(14)10-25-20(13)24/h3-8,13H,2,9-10H2,1H3/t13-/m1/s1 |
| IUPAC | |
| Molecular Weight | 332.12 |
| Pubchem Id | 169724 |
| Chembl Id | CHEMBL71339 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL71339 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
