Showing entry for (S)-(-)-Methylsuccinic acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0019951 |
| Compound Name | (S)-(-)-Methylsuccinic acid |
| Structure | ![]() |
| Formula | C5H8O4 |
| InchiKey | WXUAQHNMJWJLTG-VKHMYHEASA-N |
| SMILES | OC(=O)C[C@@H](C(=O)O)C |
| Inchi | InChI=1S/C5H8O4/c1-3(5(8)9)2-4(6)7/h3H,2H2,1H3,(H,6,7)(H,8,9)/t3-/m0/s1 |
| IUPAC | (2S)-2-methylbutanedioic acid |
| Molecular Weight | 132.04 |
| Pubchem Id | 6950476 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | SUH |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
