Showing entry for 1,2,3,9-Tetrahydropyrrolo[2,1-B]Quinazoline
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0021254 |
| Compound Name | 1,2,3,9-Tetrahydropyrrolo[2,1-B]Quinazoline |
| Structure | ![]() |
| Formula | C11H12N2 |
| InchiKey | WUFQLZTXIWKION-UHFFFAOYSA-N |
| SMILES | C1CC2=Nc3c(CN2C1)cccc3 |
| Inchi | InChI=1S/C11H12N2/c1-2-5-10-9(4-1)8-13-7-3-6-11(13)12-10/h1-2,4-5H,3,6-8H2 |
| IUPAC | 1,2,3,9-tetrahydropyrrolo[2,1-b]quinazoline |
| Molecular Weight | 172.1 |
| Pubchem Id | 442894 |
| Chembl Id | CHEMBL355821 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50289102 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL355821 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
