Showing entry for Lycoctonine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0021656 |
| Compound Name | Lycoctonine |
| Structure | ![]() |
| Formula | C25H41NO7 |
| InchiKey | YOTUXHIWBVZAJQ-IMBPCTNVSA-N |
| SMILES | CO[C@H]1C[C@@]2(O)[C@H]3[C@H]([C@@H]1C[C@H]3[C@@]13[C@@H]4[C@@]2(O)[C@@H](OC)[C@@H]1[C@@](CN4CC)(CO)CC[C@@H]3OC)OC |
| Inchi | InChI=1S/C25H41NO7/c1-6-26-11-22(12-27)8-7-16(31-3)24-14-9-13-15(30-2)10-23(28,17(14)18(13)32-4)25(29,21(24)26)20(33-5)19(22)24/h13-21,27-29H,6-12H2,1-5H3/t13-,14-,15+,16+,17-,18+,19-,20+,21-,22+,23-,24+,25+/m1/s1 |
| IUPAC | |
| Molecular Weight | 467.29 |
| Pubchem Id | 91930355 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 50369179 |
|
||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
