Showing entry for Bis(2-Methoxyethyl) Benzene-1,2-Dicarboxylate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0022629 |
| Compound Name | Bis(2-Methoxyethyl) Benzene-1,2-Dicarboxylate |
| Structure | ![]() |
| Formula | C14H18O6 |
| InchiKey | HSUIVCLOAAJSRE-UHFFFAOYSA-N |
| SMILES | COCCOC(=O)c1ccccc1C(=O)OCCOC |
| Inchi | InChI=1S/C14H18O6/c1-17-7-9-19-13(15)11-5-3-4-6-12(11)14(16)20-10-8-18-2/h3-6H,7-10H2,1-2H3 |
| IUPAC | bis(2-methoxyethyl) benzene-1,2-dicarboxylate |
| Molecular Weight | 282.11 |
| Pubchem Id | 8344 |
| Chembl Id | CHEMBL1302251 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1302251 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
