Showing entry for Icariside Ii
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0023305 |
| Compound Name | Icariside Ii |
| Structure | ![]() |
| Formula | C27H30O10 |
| InchiKey | NGMYNFJANBHLKA-XAPMVYOVSA-N |
| SMILES | COc1ccc(cc1)c1oc2c(CC=C(C)C)c(O)cc(c2c(=O)c1O[C@@H]1O[C@H](C)[C@H]([C@@H]([C@@H]1O)O)O)O |
| Inchi | InChI=1S/C27H30O10/c1-12(2)5-10-16-17(28)11-18(29)19-21(31)26(37-27-23(33)22(32)20(30)13(3)35-27)24(36-25(16)19)14-6-8-15(34-4)9-7-14/h5-9,11,13,20,22-23,27-30,32-33H,10H2,1-4H3/t13-,20-,22+,23+,27+/m1/s1 |
| IUPAC | 5,7-dihydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-3-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one |
| Molecular Weight | 514.18 |
| Pubchem Id | 44587252 |
| Chembl Id | CHEMBL497293 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50272526 |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL497293 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
