Showing entry for Aquilarabietic acid H
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0023869 |
| Compound Name | Aquilarabietic acid H |
| Structure | ![]() |
| Formula | C20H26O3 |
| InchiKey | AXKQOCLPWRXCRI-HNBVOPMISA-N |
| SMILES | OC(=O)[C@]1(C)CCC[C@]2([C@H]1C[C@@H](O)c1c2ccc(c1)C(=C)C)C |
| Inchi | InChI=1S/C20H26O3/c1-12(2)13-6-7-15-14(10-13)16(21)11-17-19(15,3)8-5-9-20(17,4)18(22)23/h6-7,10,16-17,21H,1,5,8-9,11H2,2-4H3,(H,22,23)/t16-,17-,19-,20-/m1/s1 |
| IUPAC | (1R,4aS,9R,10aR)-9-hydroxy-1,4a-dimethyl-7-prop-1-en-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
| Molecular Weight | 314.19 |
| Pubchem Id | 71578077 |
| Chembl Id | CHEMBL2333396 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2333396 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
