Showing entry for 3,4-Didehydroglabridin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0024598 |
| Compound Name | 3,4-Didehydroglabridin |
| Structure | ![]() |
| Formula | C20H18O4 |
| InchiKey | DGKSRSQXQWIQTH-UHFFFAOYSA-N |
| SMILES | Oc1ccc(c(c1)O)C1=Cc2c(OC1)c1C=CC(Oc1cc2)(C)C |
| Inchi | InChI=1S/C20H18O4/c1-20(2)8-7-16-18(24-20)6-3-12-9-13(11-23-19(12)16)15-5-4-14(21)10-17(15)22/h3-10,21-22H,11H2,1-2H3 |
| IUPAC | 4-(8,8-dimethyl-2H-pyrano[2,3-f]chromen-3-yl)benzene-1,3-diol |
| Molecular Weight | 322.12 |
| Pubchem Id | 102119815 |
| Chembl Id | CHEMBL4098627 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL4098627 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
