Showing entry for Scopolamine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0024926 |
| Compound Name | Scopolamine |
| Structure | ![]() |
| Formula | C17H21NO4 |
| InchiKey | STECJAGHUSJQJN-YXMSTPNBSA-N |
| SMILES | OC[C@H](c1ccccc1)C(=O)OC1C[C@@H]2N([C@@H](C1)[C@H]1[C@H]2O1)C |
| Inchi | InChI=1S/C17H21NO4/c1-18-13-7-11(8-14(18)16-15(13)22-16)21-17(20)12(9-19)10-5-3-2-4-6-10/h2-6,11-16,19H,7-9H2,1H3/t12-,13+,14+,15+,16+/m1/s1 |
| IUPAC | |
| Molecular Weight | 303.15 |
| Pubchem Id | 5284456 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50368127 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
