Showing entry for cardanol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0025143 |
| Compound Name | cardanol |
| Structure | ![]() |
| Formula | C21H30O |
| InchiKey | JOLVYUIAMRUBRK-UTOQUPLUSA-N |
| SMILES | C=CC/C=C\C/C=C\CCCCCCCc1cccc(c1)O |
| Inchi | InChI=1S/C21H30O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20-17-15-18-21(22)19-20/h2,4-5,7-8,15,17-19,22H,1,3,6,9-14,16H2/b5-4-,8-7- |
| IUPAC | 3-[(8Z,11Z)-pentadeca-8,11,14-trienyl]phenol |
| Molecular Weight | 298.23 |
| Pubchem Id | 11266523 |
| Chembl Id | CHEMBL470680 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50292426 |
|
|||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL470680 |
|
|||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
