Showing entry for Fagomine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0025338 |
| Compound Name | Fagomine |
| Structure | ![]() |
| Formula | C6H13NO3 |
| InchiKey | YZNNBIPIQWYLDM-SRQIZXRXSA-N |
| SMILES | OC[C@H]1NCC[C@@H]([C@H]1O)O |
| Inchi | InChI=1S/C6H13NO3/c8-3-4-6(10)5(9)1-2-7-4/h4-10H,1-3H2/t4-,5+,6+/m1/s1 |
| IUPAC | (2R,3S,4S)-2-(hydroxymethyl)piperidine-3,4-diol |
| Molecular Weight | 147.09 |
| Pubchem Id | 10678391 |
| Chembl Id | CHEMBL505237 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50379060 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL505237 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
