Showing entry for 1-(2-Hydroxy-4-Methoxyphenyl)-3-(4-Hydroxyphenyl)Prop-2-En-1-One
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0026968 |
| Compound Name | 1-(2-Hydroxy-4-Methoxyphenyl)-3-(4-Hydroxyphenyl)Prop-2-En-1-One |
| Structure | ![]() |
| Formula | C16H14O4 |
| InchiKey | MOESXQFGHNEYAH-RUDMXATFSA-N |
| SMILES | COc1ccc(c(c1)O)C(=O)/C=C/c1ccc(cc1)O |
| Inchi | InChI=1S/C16H14O4/c1-20-13-7-8-14(16(19)10-13)15(18)9-4-11-2-5-12(17)6-3-11/h2-10,17,19H,1H3/b9-4+ |
| IUPAC | (E)-1-(2-hydroxy-4-methoxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
| Molecular Weight | 270.09 |
| Pubchem Id | 6537040 |
| Chembl Id | CHEMBL2333805 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2333805 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
