Showing entry for 10-Hydroxyliriodenine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0027678 |
| Compound Name | 10-Hydroxyliriodenine |
| Structure | ![]() |
| Formula | C17H9NO4 |
| InchiKey | BCIADXOEPDQMOD-UHFFFAOYSA-N |
| SMILES | Oc1ccc2c(c1)c1c3OCOc3cc3c1c(C2=O)ncc3 |
| Inchi | InChI=1S/C17H9NO4/c19-9-1-2-10-11(6-9)14-13-8(3-4-18-15(13)16(10)20)5-12-17(14)22-7-21-12/h1-6,19H,7H2 |
| IUPAC | |
| Molecular Weight | 291.05 |
| Pubchem Id | 11779019 |
| Chembl Id | CHEMBL499126 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL499126 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
