Showing entry for Cardanol diene
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0027714 |
| Compound Name | Cardanol diene |
| Structure | ![]() |
| Formula | C21H32O |
| InchiKey | FAYVLNWNMNHXGA-UTOQUPLUSA-N |
| SMILES | CCC/C=C\C/C=C\CCCCCCCc1cccc(c1)O |
| Inchi | InChI=1S/C21H32O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20-17-15-18-21(22)19-20/h4-5,7-8,15,17-19,22H,2-3,6,9-14,16H2,1H3/b5-4-,8-7- |
| IUPAC | 3-[(8Z,11Z)-pentadeca-8,11-dienyl]phenol |
| Molecular Weight | 300.25 |
| Pubchem Id | 11098630 |
| Chembl Id | CHEMBL470887 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50292427 |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL470887 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
