Showing entry for (+)-cis-Khellactone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0027965 |
| Compound Name | (+)-cis-Khellactone |
| Structure | ![]() |
| Formula | C14H14O5 |
| InchiKey | HKXQUNNSKMWIKJ-DGCLKSJQSA-N |
| SMILES | O=c1ccc2c(o1)c1c(cc2)OC([C@@H]([C@@H]1O)O)(C)C |
| Inchi | InChI=1S/C14H14O5/c1-14(2)13(17)11(16)10-8(19-14)5-3-7-4-6-9(15)18-12(7)10/h3-6,11,13,16-17H,1-2H3/t11-,13-/m1/s1 |
| IUPAC | (9R,10R)-9,10-dihydroxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one |
| Molecular Weight | 262.08 |
| Pubchem Id | 455821 |
| Chembl Id | CHEMBL68727 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50069687 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL68727 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
