Showing entry for Acetylalkannin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0028587 |
| Compound Name | Acetylalkannin |
| Structure | ![]() |
| Formula | C18H18O6 |
| InchiKey | WNFXUXZJJKTDOZ-HNNXBMFYSA-N |
| SMILES | CC(=O)O[C@H](C1=CC(=O)c2c(C1=O)c(O)ccc2O)CC=C(C)C |
| Inchi | InChI=1S/C18H18O6/c1-9(2)4-7-15(24-10(3)19)11-8-14(22)16-12(20)5-6-13(21)17(16)18(11)23/h4-6,8,15,20-21H,7H2,1-3H3/t15-/m0/s1 |
| IUPAC | [(1S)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] acetate |
| Molecular Weight | 330.11 |
| Pubchem Id | 9967285 |
| Chembl Id | CHEMBL112415 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL112415 |
|
|||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
