Showing entry for (-)-Higenamine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0028991 |
| Compound Name | (-)-Higenamine |
| Structure | ![]() |
| Formula | C16H17NO3 |
| InchiKey | WZRCQWQRFZITDX-AWEZNQCLSA-N |
| SMILES | Oc1ccc(cc1)C[C@@H]1NCCc2c1cc(O)c(c2)O |
| Inchi | InChI=1S/C16H17NO3/c18-12-3-1-10(2-4-12)7-14-13-9-16(20)15(19)8-11(13)5-6-17-14/h1-4,8-9,14,17-20H,5-7H2/t14-/m0/s1 |
| IUPAC | (1S)-1-[(4-hydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| Molecular Weight | 271.12 |
| Pubchem Id | 440927 |
| Chembl Id | CHEMBL470491 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL470491 |
|
|||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
