Showing entry for Nodakenetin Tiglate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0029390 |
| Compound Name | Nodakenetin Tiglate |
| Structure | ![]() |
| Formula | C19H20O5 |
| InchiKey | HHNCJFKRMZDTHW-QHQPLOKBSA-N |
| SMILES | C/C=C(/C(=O)OC([C@@H]1Oc2c(C1)cc1c(c2)oc(=O)cc1)(C)C)\C |
| Inchi | InChI=1S/C19H20O5/c1-5-11(2)18(21)24-19(3,4)16-9-13-8-12-6-7-17(20)23-14(12)10-15(13)22-16/h5-8,10,16H,9H2,1-4H3/b11-5+/t16-/m1/s1 |
| IUPAC | 2-[(2R)-7-oxo-2,3-dihydrofuro[3,2-g]chromen-2-yl]propan-2-yl (E)-2-methylbut-2-enoate |
| Molecular Weight | 328.13 |
| Pubchem Id | 906523 |
| Chembl Id | CHEMBL1578874 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1578874 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
