Showing entry for 4-(2-Phenylpropan-2-Yl)Phenol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0029905 |
| Compound Name | 4-(2-Phenylpropan-2-Yl)Phenol |
| Structure | ![]() |
| Formula | C15H16O |
| InchiKey | QBDSZLJBMIMQRS-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1)C(c1ccccc1)(C)C |
| Inchi | InChI=1S/C15H16O/c1-15(2,12-6-4-3-5-7-12)13-8-10-14(16)11-9-13/h3-11,16H,1-2H3 |
| IUPAC | 4-(2-phenylpropan-2-yl)phenol |
| Molecular Weight | 212.12 |
| Pubchem Id | 11742 |
| Chembl Id | CHEMBL194805 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | DB06902 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | 1OH |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 29609 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL194805 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
