Showing entry for flavinantine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0030052 |
| Compound Name | flavinantine |
| Structure | ![]() |
| Formula | C19H21NO4 |
| InchiKey | GSNZKNRMDZYEAI-AUUYWEPGSA-N |
| SMILES | COC1=C[C@@]23CCN([C@@H](C2=CC1=O)Cc1c3cc(O)c(c1)OC)C |
| Inchi | InChI=1S/C19H21NO4/c1-20-5-4-19-10-18(24-3)16(22)9-13(19)14(20)6-11-7-17(23-2)15(21)8-12(11)19/h7-10,14,21H,4-6H2,1-3H3/t14-,19-/m1/s1 |
| IUPAC | |
| Molecular Weight | 327.15 |
| Pubchem Id | 5491380 |
| Chembl Id | CHEMBL463084 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL463084 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
