Showing entry for Cremastrine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0030978 |
| Compound Name | Cremastrine |
| Structure | ![]() |
| Formula | C14H25NO3 |
| InchiKey | AVBKRVFZNFJQBK-FVCCEPFGSA-N |
| SMILES | CC[C@H]([C@H](C(=O)OC[C@H]1CCN2[C@H]1CCC2)O)C |
| Inchi | InChI=1S/C14H25NO3/c1-3-10(2)13(16)14(17)18-9-11-6-8-15-7-4-5-12(11)15/h10-13,16H,3-9H2,1-2H3/t10-,11-,12+,13-/m1/s1 |
| IUPAC | [(1S,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl (2R,3R)-2-hydroxy-3-methylpentanoate |
| Molecular Weight | 255.18 |
| Pubchem Id | 656392 |
| Chembl Id | CHEMBL480464 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50259847 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL480464 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
