Showing entry for ACTIPHENOL
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0031457 |
| Compound Name | ACTIPHENOL |
| Structure | ![]() |
| Formula | C15H17NO4 |
| InchiKey | YTLMIHBTPWTPEV-UHFFFAOYSA-N |
| SMILES | OC1=NC(=O)CC(C1)CC(=O)c1cc(C)cc(c1O)C |
| Inchi | InChI=1S/C15H17NO4/c1-8-3-9(2)15(20)11(4-8)12(17)5-10-6-13(18)16-14(19)7-10/h3-4,10,20H,5-7H2,1-2H3,(H,16,18,19) |
| IUPAC | 4-[2-(2-hydroxy-3,5-dimethylphenyl)-2-oxoethyl]piperidine-2,6-dione |
| Molecular Weight | 275.12 |
| Pubchem Id | 245940 |
| Chembl Id | CHEMBL3186963 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 100273 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3186963 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
