Showing entry for 3'-Hydroxy-4'-O-methylglabridin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0033761 |
| Compound Name | 3'-Hydroxy-4'-O-methylglabridin |
| Structure | ![]() |
| Formula | C21H22O5 |
| InchiKey | PPBISUGOQDBBEL-ZDUSSCGKSA-N |
| SMILES | COc1ccc(c(c1O)O)[C@@H]1COc2c(C1)ccc1c2C=CC(O1)(C)C |
| Inchi | InChI=1S/C21H22O5/c1-21(2)9-8-15-16(26-21)6-4-12-10-13(11-25-20(12)15)14-5-7-17(24-3)19(23)18(14)22/h4-9,13,22-23H,10-11H2,1-3H3/t13-/m0/s1 |
| IUPAC | 3-[(3R)-8,8-dimethyl-3,4-dihydro-2H-pyrano[2,3-f]chromen-3-yl]-6-methoxybenzene-1,2-diol |
| Molecular Weight | 354.15 |
| Pubchem Id | 15228662 |
| Chembl Id | CHEMBL4082654 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL4082654 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
