Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0033892 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C24H30O8 |
| InchiKey | FMNRNKYPJCPOQN-UHFFFAOYSA-N |
| SMILES | CCCC(=O)C1=C(O)C(C(=C(C1=O)CC1=C(O)C(C(=C(C1=O)C(=O)CC)O)(C)C)O)(C)C |
| Inchi | InChI=1S/C24H30O8/c1-7-9-14(26)16-18(28)12(20(30)24(5,6)22(16)32)10-11-17(27)15(13(25)8-2)21(31)23(3,4)19(11)29/h29-32H,7-10H2,1-6H3 |
| IUPAC | |
| Molecular Weight | 446.19 |
| Pubchem Id | |
| Chembl Id | CHEMBL3706853 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3706853 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
