Showing entry for Methylbrevifolin Carboxylate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0035448 |
| Compound Name | Methylbrevifolin Carboxylate |
| Structure | ![]() |
| Formula | C14H10O8 |
| InchiKey | JNWDNAASYHRXMG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC(=O)c2c1c1c(O)c(O)c(cc1c(=O)o2)O |
| Inchi | InChI=1S/C14H10O8/c1-21-13(19)5-3-7(16)12-9(5)8-4(14(20)22-12)2-6(15)10(17)11(8)18/h2,5,15,17-18H,3H2,1H3 |
| IUPAC | methyl 7,8,9-trihydroxy-3,5-dioxo-1,2-dihydrocyclopenta[c]isochromene-1-carboxylate |
| Molecular Weight | 306.04 |
| Pubchem Id | 5319518 |
| Chembl Id | CHEMBL567076 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50415047 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL567076 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
