Showing entry for 1,4-Imino-1,2,4-Trideoxy-D-Arabinitol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0036355 |
| Compound Name | 1,4-Imino-1,2,4-Trideoxy-D-Arabinitol |
| Structure | ![]() |
| Formula | C5H11NO2 |
| InchiKey | TYLFLHPQWQQWRD-UHNVWZDZSA-N |
| SMILES | OC[C@H]1NCC[C@@H]1O |
| Inchi | InChI=1S/C5H11NO2/c7-3-4-5(8)1-2-6-4/h4-8H,1-3H2/t4-,5+/m1/s1 |
| IUPAC | (2R,3S)-2-(hydroxymethyl)pyrrolidin-3-ol |
| Molecular Weight | 117.08 |
| Pubchem Id | 11073391 |
| Chembl Id | CHEMBL408355 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50375512 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL408355 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
