Showing entry for Tetrahydrofuroguaiacin B
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0037782 |
| Compound Name | Tetrahydrofuroguaiacin B |
| Structure | ![]() |
| Formula | C20H24O5 |
| InchiKey | GMXMKSFJQLFOSO-SRRICDNISA-N |
| SMILES | COc1cc(ccc1O)[C@@H]1O[C@@H]([C@@H]([C@@H]1C)C)c1ccc(c(c1)OC)O |
| Inchi | InChI=1S/C20H24O5/c1-11-12(2)20(14-6-8-16(22)18(10-14)24-4)25-19(11)13-5-7-15(21)17(9-13)23-3/h5-12,19-22H,1-4H3/t11-,12+,19+,20- |
| IUPAC | 4-[(2R,3S,4R,5S)-5-(4-hydroxy-3-methoxyphenyl)-3,4-dimethyloxolan-2-yl]-2-methoxyphenol |
| Molecular Weight | 344.16 |
| Pubchem Id | 13870572 |
| Chembl Id | CHEMBL1170325 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1170325 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
