Showing entry for Dihydrowithaferin A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0038100 |
| Compound Name | Dihydrowithaferin A |
| Structure | ![]() |
| Formula | C28H40O6 |
| InchiKey | YRXCLNDPESBJHL-CKNDUULBSA-N |
| SMILES | OCC1=C(C)C[C@@H](OC1=O)[C@H]([C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2C[C@@H]2[C@]3([C@]1(C)C(=O)CC[C@@H]3O)O2)C |
| Inchi | InChI=1S/C28H40O6/c1-14-11-21(33-25(32)17(14)13-29)15(2)18-5-6-19-16-12-24-28(34-24)23(31)8-7-22(30)27(28,4)20(16)9-10-26(18,19)3/h15-16,18-21,23-24,29,31H,5-13H2,1-4H3/t15-,16-,18+,19-,20-,21+,23-,24+,26+,27-,28+/m0/s1 |
| IUPAC | |
| Molecular Weight | 472.28 |
| Pubchem Id | 15411208 |
| Chembl Id | CHEMBL1934585 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1934585 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
