Showing entry for calystegine B(2)
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0038744 |
| Compound Name | calystegine B(2) |
| Structure | ![]() |
| Formula | C7H13NO4 |
| InchiKey | FXFBVZOJVHCEDO-BNWJMWRWSA-N |
| SMILES | O[C@@H]1[C@H]2CC[C@](N2)([C@H]([C@@H]1O)O)O |
| Inchi | InChI=1S/C7H13NO4/c9-4-3-1-2-7(12,8-3)6(11)5(4)10/h3-6,8-12H,1-2H2/t3-,4-,5-,6+,7-/m1/s1 |
| IUPAC | (1R,2R,3R,4S,5R)-8-azabicyclo[3.2.1]octane-2,3,4,5-tetrol |
| Molecular Weight | 175.08 |
| Pubchem Id | 10559162 |
| Chembl Id | CHEMBL3233945 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50002909 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3233945 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
