Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0039262 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C28H38O7 |
| InchiKey | DMGHRMQAHYJTHX-YZYVTENCSA-N |
| SMILES | CC1=C(C)C(=O)O[C@H](C1)[C@@]([C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2[C@@H](O)[C@@H]2[C@]3([C@]1(C)C(=O)C=C[C@@H]3O)O2)(O)C |
| Inchi | InChI=1S/C28H38O7/c1-13-12-20(34-24(32)14(13)2)27(5,33)17-7-6-15-21-16(10-11-25(15,17)3)26(4)18(29)8-9-19(30)28(26)23(35-28)22(21)31/h8-9,15-17,19-23,30-31,33H,6-7,10-12H2,1-5H3/t15-,16-,17-,19-,20+,21-,22+,23+,25-,26-,27+,28+/m0/s1 |
| IUPAC | |
| Molecular Weight | 486.26 |
| Pubchem Id | 23266160 |
| Chembl Id | CHEMBL506683 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL506683 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
