Showing entry for costunolide
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0039578 |
| Compound Name | costunolide |
| Structure | ![]() |
| Formula | C15H20O2 |
| InchiKey | HRYLQFBHBWLLLL-IKTIWSOHSA-N |
| SMILES | C/C/1=C/[C@H]2OC(=O)C(=C)[C@@H]2CC/C(=C\CC1)/C |
| Inchi | InChI=1S/C15H20O2/c1-10-5-4-6-11(2)9-14-13(8-7-10)12(3)15(16)17-14/h5,9,13-14H,3-4,6-8H2,1-2H3/b10-5-,11-9-/t13-,14+/m0/s1 |
| IUPAC | (3aS,6Z,10Z,11aR)-6,10-dimethyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one |
| Molecular Weight | 232.15 |
| Pubchem Id | 5458201 |
| Chembl Id | CHEMBL190377 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL190377 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
