Showing entry for senkyunolide I
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0040683 |
| Compound Name | senkyunolide I |
| Structure | ![]() |
| Formula | C12H16O4 |
| InchiKey | DQNGMIQSXNGHOA-BVVGKJRVSA-N |
| SMILES | CCC/C=C/1\OC(=O)C2=C1CC[C@H]([C@@H]2O)O |
| Inchi | InChI=1S/C12H16O4/c1-2-3-4-9-7-5-6-8(13)11(14)10(7)12(15)16-9/h4,8,11,13-14H,2-3,5-6H2,1H3/b9-4-/t8-,11+/m1/s1 |
| IUPAC | (3Z,6R,7R)-3-butylidene-6,7-dihydroxy-4,5,6,7-tetrahydro-2-benzofuran-1-one |
| Molecular Weight | 224.1 |
| Pubchem Id | 13965087 |
| Chembl Id | CHEMBL499542 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL499542 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
