Showing entry for Quercetin 3-O-Rhamnopyranoside
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042180 |
| Compound Name | Quercetin 3-O-Rhamnopyranoside |
| Structure | ![]() |
| Formula | C21H20O11 |
| InchiKey | OXGUCUVFOIWWQJ-GPTQEAJUSA-N |
| SMILES | Oc1cc(O)c2c(c1)oc(c(c2=O)OC1O[C@H](C)[C@H]([C@@H]([C@@H]1O)O)O)c1ccc(c(c1)O)O |
| Inchi | InChI=1S/C21H20O11/c1-7-15(26)17(28)18(29)21(30-7)32-20-16(27)14-12(25)5-9(22)6-13(14)31-19(20)8-2-3-10(23)11(24)4-8/h2-7,15,17-18,21-26,28-29H,1H3/t7-,15-,17+,18+,21?/m1/s1 |
| IUPAC | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one |
| Molecular Weight | 448.1 |
| Pubchem Id | 18604930 |
| Chembl Id | CHEMBL479232 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL479232 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
