Showing entry for Ascorbic Acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042250 |
| Compound Name | Ascorbic Acid |
| Structure | ![]() |
| Formula | C6H8O6.Na |
| InchiKey | PPASLZSBLFJQEF-RXSVEWSESA-M |
| SMILES | OC[C@@H]([C@H]1OC(=O)C(=C1[O-])O)O.[Na+] |
| Inchi | InChI=1S/C6H8O6.Na/c7-1-2(8)5-3(9)4(10)6(11)12-5;/h2,5,7-10H,1H2;/q;+1/p-1/t2-,5+;/m0./s1 |
| IUPAC | |
| Molecular Weight | 175.02 |
| Pubchem Id | 23667548 |
| Chembl Id | CHEMBL591665 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL591665 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
