Showing entry for acerogenin C
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042332 |
| Compound Name | acerogenin C |
| Structure | ![]() |
| Formula | C19H20O3 |
| InchiKey | DMCJCKWHLCLVNV-UHFFFAOYSA-N |
| SMILES | O=C1CCCCc2ccc(c(c2)Oc2ccc(CC1)cc2)O |
| Inchi | InChI=1S/C19H20O3/c20-16-4-2-1-3-15-8-12-18(21)19(13-15)22-17-10-6-14(5-9-16)7-11-17/h6-8,10-13,21H,1-5,9H2 |
| IUPAC | |
| Molecular Weight | 296.14 |
| Pubchem Id | 10040223 |
| Chembl Id | CHEMBL589990 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL589990 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
