Showing entry for cylindol A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042448 |
| Compound Name | cylindol A |
| Structure | ![]() |
| Formula | C16H14O7 |
| InchiKey | OEYSNLOOZVNLRA-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(c(c1)Oc1cc(ccc1O)C(=O)OC)O |
| Inchi | InChI=1S/C16H14O7/c1-21-15(19)9-3-5-11(17)13(7-9)23-14-8-10(16(20)22-2)4-6-12(14)18/h3-8,17-18H,1-2H3 |
| IUPAC | |
| Molecular Weight | 318.07 |
| Pubchem Id | 10425993 |
| Chembl Id | CHEMBL471083 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL471083 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
