Showing entry for 4-Gingerol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042971 |
| Compound Name | 4-Gingerol |
| Structure | ![]() |
| Formula | C15H22O4 |
| InchiKey | GDRKZARFCIYVCI-UHFFFAOYSA-N |
| SMILES | CCCC(CC(=O)CCc1ccc(c(c1)OC)O)O |
| Inchi | InChI=1S/C15H22O4/c1-3-4-12(16)10-13(17)7-5-11-6-8-14(18)15(9-11)19-2/h6,8-9,12,16,18H,3-5,7,10H2,1-2H3 |
| IUPAC | 5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)octan-3-one |
| Molecular Weight | 266.15 |
| Pubchem Id | 5317596 |
| Chembl Id | CHEMBL3883439 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 50210051 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3883439 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
