Showing entry for aceroside VII
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0044733 |
| Compound Name | aceroside VII |
| Structure | ![]() |
| Formula | C26H36O8 |
| InchiKey | LUTXQCYAZCYAHY-DJZLDEFYSA-N |
| SMILES | OC[C@H]1O[C@@H](O[C@@H](CCc2ccc(cc2)O)CCCCc2ccc(cc2)O)[C@@H]([C@H]([C@@H]1O)CO)O |
| Inchi | InChI=1S/C26H36O8/c27-15-22-24(31)23(16-28)34-26(25(22)32)33-21(14-9-18-7-12-20(30)13-8-18)4-2-1-3-17-5-10-19(29)11-6-17/h5-8,10-13,21-32H,1-4,9,14-16H2/t21-,22+,23-,24+,25-,26-/m1/s1 |
| IUPAC | |
| Molecular Weight | 476.24 |
| Pubchem Id | 46889080 |
| Chembl Id | CHEMBL1098687 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1098687 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
