Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0044919 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C31H44O10 |
| InchiKey | NQZMSBJCERRKFD-ZMTLGYQDSA-N |
| SMILES | OC[C@H]1O[C@@H](O[C@H]2[C@@H](C[C@H]([C@]3([C@@H]2C(=CC[C@@H]3O)C)C)CC(=O)/C=C/c2ccc(cc2)O)C(O)(C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Inchi | InChI=1S/C31H44O10/c1-16-5-12-23(35)31(4)18(13-20(34)11-8-17-6-9-19(33)10-7-17)14-21(30(2,3)39)28(24(16)31)41-29-27(38)26(37)25(36)22(15-32)40-29/h5-11,18,21-29,32-33,35-39H,12-15H2,1-4H3/b11-8+/t18-,21-,22-,23+,24-,25-,26+,27-,28+,29+,31-/m1/s1 |
| IUPAC | |
| Molecular Weight | 576.29 |
| Pubchem Id | 70681005 |
| Chembl Id | CHEMBL2011644 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2011644 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
