Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045212 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C34H46O6 |
| InchiKey | LRCJVQJYXQCXDX-PNURKKAPSA-N |
| SMILES | CCCCCCCC/C=C\C/C=C\CCCCC(=O)O[C@@H](C1=CC(=O)c2c(C1=O)c(O)ccc2O)CC=C(C)C |
| Inchi | InChI=1S/C34H46O6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-31(38)40-30(23-20-25(2)3)26-24-29(37)32-27(35)21-22-28(36)33(32)34(26)39/h11-12,14-15,20-22,24,30,35-36H,4-10,13,16-19,23H2,1-3H3/b12-11-,15-14-/t30-/m1/s1 |
| IUPAC | |
| Molecular Weight | 550.33 |
| Pubchem Id | 44438574 |
| Chembl Id | CHEMBL247861 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL247861 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
