Showing entry for COCHINCHINENENE A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045233 |
| Compound Name | COCHINCHINENENE A |
| Structure | ![]() |
| Formula | C33H34O6 |
| InchiKey | IEXCFHSPKFFVGU-AATRIKPKSA-N |
| SMILES | COc1ccc(cc1)C(c1c(OC)cc(cc1OC)/C=C/c1ccc(cc1)O)CCc1ccc(cc1OC)O |
| Inchi | InChI=1S/C33H34O6/c1-36-28-16-10-24(11-17-28)29(18-12-25-9-15-27(35)21-30(25)37-2)33-31(38-3)19-23(20-32(33)39-4)6-5-22-7-13-26(34)14-8-22/h5-11,13-17,19-21,29,34-35H,12,18H2,1-4H3/b6-5+ |
| IUPAC | |
| Molecular Weight | 526.24 |
| Pubchem Id | 23655742 |
| Chembl Id | CHEMBL254229 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50222764 |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL254229 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
